C8H5Cl2NOS — CID 22009585
4-(chloromethyl)-2-(3-chlorothiophen-2-yl)-1,3-oxazole (PubChem CID 22009585) has the molecular formula C8H5Cl2NOS and a molecular weight of 234.11 g/mol. Its IUPAC name is 4-(chloromethyl)-2-(3-chlorothiophen-2-yl)-1,3-oxazole.
| Compound Name | 4-(chloromethyl)-2-(3-chlorothiophen-2-yl)-1,3-oxazole |
|---|---|
| PubChem CID | 22009585 |
| Molecular Formula | C8H5Cl2NOS |
| Molecular Weight | 234.11 g/mol |
| Exact Mass | 232.95 |
| IUPAC Name | 4-(chloromethyl)-2-(3-chlorothiophen-2-yl)-1,3-oxazole |
| SMILES | ClCc1coc(-c2sccc2Cl)n1 |
| InChI | InChI=1S/C8H5Cl2NOS/c9-3-5-4-12-8(11-5)7-6(10)1-2-13-7/h1-2,4H,3H2 |
| InChIKey | YFZJLIKSAIAEMP-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.11 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|