C7H4ClIN2OS — CID 103407386
2-(3-chloro-4-methylthiophen-2-yl)-5-iodo-1,3,4-oxadiazole (PubChem CID 103407386) has the molecular formula C7H4ClIN2OS and a molecular weight of 326.55 g/mol. Its IUPAC name is 2-(3-chloro-4-methylthiophen-2-yl)-5-iodo-1,3,4-oxadiazole.
| Compound Name | 2-(3-chloro-4-methylthiophen-2-yl)-5-iodo-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 103407386 |
| Molecular Formula | C7H4ClIN2OS |
| Molecular Weight | 326.55 g/mol |
| Exact Mass | 325.88 |
| IUPAC Name | 2-(3-chloro-4-methylthiophen-2-yl)-5-iodo-1,3,4-oxadiazole |
| SMILES | Cc1csc(-c2nnc(I)o2)c1Cl |
| InChI | InChI=1S/C7H4ClIN2OS/c1-3-2-13-5(4(3)8)6-10-11-7(9)12-6/h2H,1H3 |
| InChIKey | DGVKOJNFCCANLH-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.55 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|