C12H9ClN2O2 — CID 175553217
5-[4-(chloromethyl)-1,3-oxazol-2-yl]-2-methoxybenzonitrile (PubChem CID 175553217) has the molecular formula C12H9ClN2O2 and a molecular weight of 248.67 g/mol. Its IUPAC name is 5-[4-(chloromethyl)-1,3-oxazol-2-yl]-2-methoxybenzonitrile.
| Compound Name | 5-[4-(chloromethyl)-1,3-oxazol-2-yl]-2-methoxybenzonitrile |
|---|---|
| PubChem CID | 175553217 |
| Molecular Formula | C12H9ClN2O2 |
| Molecular Weight | 248.67 g/mol |
| Exact Mass | 248.04 |
| IUPAC Name | 5-[4-(chloromethyl)-1,3-oxazol-2-yl]-2-methoxybenzonitrile |
| SMILES | COc1ccc(-c2nc(CCl)co2)cc1C#N |
| InChI | InChI=1S/C12H9ClN2O2/c1-16-11-3-2-8(4-9(11)6-14)12-15-10(5-13)7-17-12/h2-4,7H,5H2,1H3 |
| InChIKey | XHIOYBSTEVSZMZ-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 59.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.67 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|