C13H12N4O2 — CID 69424980
2-(4-methoxyphenyl)-4-(triazol-1-ylmethyl)-1,3-oxazole (PubChem CID 69424980) has the molecular formula C13H12N4O2 and a molecular weight of 256.27 g/mol. Its IUPAC name is 2-(4-methoxyphenyl)-4-(triazol-1-ylmethyl)-1,3-oxazole.
| Compound Name | 2-(4-methoxyphenyl)-4-(triazol-1-ylmethyl)-1,3-oxazole |
|---|---|
| PubChem CID | 69424980 |
| Molecular Formula | C13H12N4O2 |
| Molecular Weight | 256.27 g/mol |
| Exact Mass | 256.10 |
| IUPAC Name | 2-(4-methoxyphenyl)-4-(triazol-1-ylmethyl)-1,3-oxazole |
| SMILES | COc1ccc(-c2nc(Cn3ccnn3)co2)cc1 |
| InChI | InChI=1S/C13H12N4O2/c1-18-12-4-2-10(3-5-12)13-15-11(9-19-13)8-17-7-6-14-16-17/h2-7,9H,8H2,1H3 |
| InChIKey | CEJFZZVCBONBGT-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 65.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.27 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |