C18H18N2O2 — CID 56672873
4-methoxy-N-[[2-(4-methylphenyl)-1,3-oxazol-4-yl]methyl]aniline (PubChem CID 56672873) has the molecular formula C18H18N2O2 and a molecular weight of 294.35 g/mol. Its IUPAC name is 4-methoxy-N-[[2-(4-methylphenyl)-1,3-oxazol-4-yl]methyl]aniline.
| Compound Name | 4-methoxy-N-[[2-(4-methylphenyl)-1,3-oxazol-4-yl]methyl]aniline |
|---|---|
| PubChem CID | 56672873 |
| Molecular Formula | C18H18N2O2 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.14 |
| IUPAC Name | 4-methoxy-N-[[2-(4-methylphenyl)-1,3-oxazol-4-yl]methyl]aniline |
| SMILES | COc1ccc(NCc2coc(-c3ccc(C)cc3)n2)cc1 |
| InChI | InChI=1S/C18H18N2O2/c1-13-3-5-14(6-4-13)18-20-16(12-22-18)11-19-15-7-9-17(21-2)10-8-15/h3-10,12,19H,11H2,1-2H3 |
| InChIKey | INNOOLLLPQHSJG-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 47.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|