C18H15N3O2 — CID 166339062
4-[[2-(3-methoxyphenyl)-1,3-oxazol-4-yl]methylamino]benzonitrile (PubChem CID 166339062) has the molecular formula C18H15N3O2 and a molecular weight of 305.34 g/mol. Its IUPAC name is 4-[[2-(3-methoxyphenyl)-1,3-oxazol-4-yl]methylamino]benzonitrile.
| Compound Name | 4-[[2-(3-methoxyphenyl)-1,3-oxazol-4-yl]methylamino]benzonitrile |
|---|---|
| PubChem CID | 166339062 |
| Molecular Formula | C18H15N3O2 |
| Molecular Weight | 305.34 g/mol |
| Exact Mass | 305.12 |
| IUPAC Name | 4-[[2-(3-methoxyphenyl)-1,3-oxazol-4-yl]methylamino]benzonitrile |
| SMILES | COc1cccc(-c2nc(CNc3ccc(C#N)cc3)co2)c1 |
| InChI | InChI=1S/C18H15N3O2/c1-22-17-4-2-3-14(9-17)18-21-16(12-23-18)11-20-15-7-5-13(10-19)6-8-15/h2-9,12,20H,11H2,1H3 |
| InChIKey | ODDIZNYNDSEEGQ-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 71.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.34 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |