C22H17FN2O2 — CID 56682804
N-[[2-(3-fluorophenyl)-1,3-oxazol-4-yl]methyl]-4-phenoxyaniline (PubChem CID 56682804) has the molecular formula C22H17FN2O2 and a molecular weight of 360.39 g/mol. Its IUPAC name is N-[[2-(3-fluorophenyl)-1,3-oxazol-4-yl]methyl]-4-phenoxyaniline.
| Compound Name | N-[[2-(3-fluorophenyl)-1,3-oxazol-4-yl]methyl]-4-phenoxyaniline |
|---|---|
| PubChem CID | 56682804 |
| Molecular Formula | C22H17FN2O2 |
| Molecular Weight | 360.39 g/mol |
| Exact Mass | 360.13 |
| IUPAC Name | N-[[2-(3-fluorophenyl)-1,3-oxazol-4-yl]methyl]-4-phenoxyaniline |
| SMILES | Fc1cccc(-c2nc(CNc3ccc(Oc4ccccc4)cc3)co2)c1 |
| InChI | InChI=1S/C22H17FN2O2/c23-17-6-4-5-16(13-17)22-25-19(15-26-22)14-24-18-9-11-21(12-10-18)27-20-7-2-1-3-8-20/h1-13,15,24H,14H2 |
| InChIKey | ODJOIFNJLUFNEP-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 47.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.39 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |