C18H14FNO4 — CID 34061652
methyl 3-[[2-(3-fluorophenyl)-1,3-oxazol-4-yl]methoxy]benzoate (PubChem CID 34061652) has the molecular formula C18H14FNO4 and a molecular weight of 327.31 g/mol. Its IUPAC name is methyl 3-[[2-(3-fluorophenyl)-1,3-oxazol-4-yl]methoxy]benzoate.
| Compound Name | methyl 3-[[2-(3-fluorophenyl)-1,3-oxazol-4-yl]methoxy]benzoate |
|---|---|
| PubChem CID | 34061652 |
| Molecular Formula | C18H14FNO4 |
| Molecular Weight | 327.31 g/mol |
| Exact Mass | 327.09 |
| IUPAC Name | methyl 3-[[2-(3-fluorophenyl)-1,3-oxazol-4-yl]methoxy]benzoate |
| SMILES | COC(=O)c1cccc(OCc2coc(-c3cccc(F)c3)n2)c1 |
| InChI | InChI=1S/C18H14FNO4/c1-22-18(21)13-5-3-7-16(9-13)23-10-15-11-24-17(20-15)12-4-2-6-14(19)8-12/h2-9,11H,10H2,1H3 |
| InChIKey | HJAPYDYFOCYOFK-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 61.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.31 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |