C15H17N3O — CID 65287867
3-[4-[(tert-butylamino)methyl]-1,3-oxazol-2-yl]benzonitrile (PubChem CID 65287867) has the molecular formula C15H17N3O and a molecular weight of 255.32 g/mol. Its IUPAC name is 3-[4-[(tert-butylamino)methyl]-1,3-oxazol-2-yl]benzonitrile.
| Compound Name | 3-[4-[(tert-butylamino)methyl]-1,3-oxazol-2-yl]benzonitrile |
|---|---|
| PubChem CID | 65287867 |
| Molecular Formula | C15H17N3O |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.14 |
| IUPAC Name | 3-[4-[(tert-butylamino)methyl]-1,3-oxazol-2-yl]benzonitrile |
| SMILES | CC(C)(C)NCc1coc(-c2cccc(C#N)c2)n1 |
| InChI | InChI=1S/C15H17N3O/c1-15(2,3)17-9-13-10-19-14(18-13)12-6-4-5-11(7-12)8-16/h4-7,10,17H,9H2,1-3H3 |
| InChIKey | MALGRKLLIZWPOH-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 61.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |