C13H13N3O — CID 65288463
4-[4-(ethylaminomethyl)-1,3-oxazol-2-yl]benzonitrile (PubChem CID 65288463) has the molecular formula C13H13N3O and a molecular weight of 227.27 g/mol. Its IUPAC name is 4-[4-(ethylaminomethyl)-1,3-oxazol-2-yl]benzonitrile.
| Compound Name | 4-[4-(ethylaminomethyl)-1,3-oxazol-2-yl]benzonitrile |
|---|---|
| PubChem CID | 65288463 |
| Molecular Formula | C13H13N3O |
| Molecular Weight | 227.27 g/mol |
| Exact Mass | 227.11 |
| IUPAC Name | 4-[4-(ethylaminomethyl)-1,3-oxazol-2-yl]benzonitrile |
| SMILES | CCNCc1coc(-c2ccc(C#N)cc2)n1 |
| InChI | InChI=1S/C13H13N3O/c1-2-15-8-12-9-17-13(16-12)11-5-3-10(7-14)4-6-11/h3-6,9,15H,2,8H2,1H3 |
| InChIKey | HLLWZBUEPQWHLM-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 61.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.27 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |