C12H13BrN2O — CID 65288314
N-[[2-(2-bromophenyl)-1,3-oxazol-4-yl]methyl]ethanamine (PubChem CID 65288314) has the molecular formula C12H13BrN2O and a molecular weight of 281.15 g/mol. Its IUPAC name is N-[[2-(2-bromophenyl)-1,3-oxazol-4-yl]methyl]ethanamine.
| Compound Name | N-[[2-(2-bromophenyl)-1,3-oxazol-4-yl]methyl]ethanamine |
|---|---|
| PubChem CID | 65288314 |
| Molecular Formula | C12H13BrN2O |
| Molecular Weight | 281.15 g/mol |
| Exact Mass | 280.02 |
| IUPAC Name | N-[[2-(2-bromophenyl)-1,3-oxazol-4-yl]methyl]ethanamine |
| SMILES | CCNCc1coc(-c2ccccc2Br)n1 |
| InChI | InChI=1S/C12H13BrN2O/c1-2-14-7-9-8-16-12(15-9)10-5-3-4-6-11(10)13/h3-6,8,14H,2,7H2,1H3 |
| InChIKey | FNBGPYXEYYAIPP-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.15 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |