C14H16N2O3 — CID 79411338
(3S,4R)-1-[(2-phenyl-1,3-oxazol-4-yl)methyl]pyrrolidine-3,4-diol (PubChem CID 79411338) has the molecular formula C14H16N2O3 and a molecular weight of 260.29 g/mol. Its IUPAC name is (3S,4R)-1-[(2-phenyl-1,3-oxazol-4-yl)methyl]pyrrolidine-3,4-diol.
| Compound Name | (3S,4R)-1-[(2-phenyl-1,3-oxazol-4-yl)methyl]pyrrolidine-3,4-diol |
|---|---|
| PubChem CID | 79411338 |
| Molecular Formula | C14H16N2O3 |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 260.12 |
| IUPAC Name | (3S,4R)-1-[(2-phenyl-1,3-oxazol-4-yl)methyl]pyrrolidine-3,4-diol |
| SMILES | O[C@@H]1CN(Cc2coc(-c3ccccc3)n2)C[C@@H]1O |
| InChI | InChI=1S/C14H16N2O3/c17-12-7-16(8-13(12)18)6-11-9-19-14(15-11)10-4-2-1-3-5-10/h1-5,9,12-13,17-18H,6-8H2/t12-,13+ |
| InChIKey | IZYGNGBKXCSHML-BETUJISGSA-N |
| XLogP | 0.88 |
| TPSA | 69.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.29 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |