C14H16N2O2 — CID 55169599
1-[[2-(4-methylphenyl)-1,3-oxazol-4-yl]methyl]azetidin-3-ol (PubChem CID 55169599) has the molecular formula C14H16N2O2 and a molecular weight of 244.29 g/mol. Its IUPAC name is 1-[[2-(4-methylphenyl)-1,3-oxazol-4-yl]methyl]azetidin-3-ol.
| Compound Name | 1-[[2-(4-methylphenyl)-1,3-oxazol-4-yl]methyl]azetidin-3-ol |
|---|---|
| PubChem CID | 55169599 |
| Molecular Formula | C14H16N2O2 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.12 |
| IUPAC Name | 1-[[2-(4-methylphenyl)-1,3-oxazol-4-yl]methyl]azetidin-3-ol |
| SMILES | Cc1ccc(-c2nc(CN3CC(O)C3)co2)cc1 |
| InChI | InChI=1S/C14H16N2O2/c1-10-2-4-11(5-3-10)14-15-12(9-18-14)6-16-7-13(17)8-16/h2-5,9,13,17H,6-8H2,1H3 |
| InChIKey | ZFCKSTSOLGMJBR-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 49.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |