C20H26N2O — CID 56662511
4-[[(4aS,8aS)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]methyl]-2-(4-methylphenyl)-1,3-oxazole (PubChem CID 56662511) has the molecular formula C20H26N2O and a molecular weight of 310.44 g/mol. Its IUPAC name is 4-[[(4aS,8aS)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]methyl]-2-(4-methylphenyl)-1,3-oxazole.
| Compound Name | 4-[[(4aS,8aS)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]methyl]-2-(4-methylphenyl)-1,3-oxazole |
|---|---|
| PubChem CID | 56662511 |
| Molecular Formula | C20H26N2O |
| Molecular Weight | 310.44 g/mol |
| Exact Mass | 310.20 |
| IUPAC Name | 4-[[(4aS,8aS)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]methyl]-2-(4-methylphenyl)-1,3-oxazole |
| SMILES | Cc1ccc(-c2nc(CN3CC[C@@H]4CCCC[C@@H]4C3)co2)cc1 |
| InChI | InChI=1S/C20H26N2O/c1-15-6-8-17(9-7-15)20-21-19(14-23-20)13-22-11-10-16-4-2-3-5-18(16)12-22/h6-9,14,16,18H,2-5,10-13H2,1H3/t16-,18+/m0/s1 |
| InChIKey | PERGDLGDAAXTAD-FUHWJXTLSA-N |
| XLogP | 4.66 |
| TPSA | 29.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.44 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |