C14H15ClN2O3 — CID 106672993
1-[[2-(4-chlorophenyl)-1,3-oxazol-4-yl]methyl]pyrrolidine-3,4-diol (PubChem CID 106672993) has the molecular formula C14H15ClN2O3 and a molecular weight of 294.74 g/mol. Its IUPAC name is 1-[[2-(4-chlorophenyl)-1,3-oxazol-4-yl]methyl]pyrrolidine-3,4-diol.
| Compound Name | 1-[[2-(4-chlorophenyl)-1,3-oxazol-4-yl]methyl]pyrrolidine-3,4-diol |
|---|---|
| PubChem CID | 106672993 |
| Molecular Formula | C14H15ClN2O3 |
| Molecular Weight | 294.74 g/mol |
| Exact Mass | 294.08 |
| IUPAC Name | 1-[[2-(4-chlorophenyl)-1,3-oxazol-4-yl]methyl]pyrrolidine-3,4-diol |
| SMILES | OC1CN(Cc2coc(-c3ccc(Cl)cc3)n2)CC1O |
| InChI | InChI=1S/C14H15ClN2O3/c15-10-3-1-9(2-4-10)14-16-11(8-20-14)5-17-6-12(18)13(19)7-17/h1-4,8,12-13,18-19H,5-7H2 |
| InChIKey | UDMARGSVUPSMDE-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 69.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.74 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |