About 2-(4-chlorophenyl)-4-[[4-(1H-pyrazol-5-yl)piperidin-1-yl]methyl]-1,3-oxazole
2-(4-chlorophenyl)-4-[[4-(1H-pyrazol-5-yl)piperidin-1-yl]methyl]-1,3-oxazole (PubChem CID 51104412) has the molecular formula C18H19ClN4O
and a molecular weight of 342.83 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-4-[[4-(1H-pyrazol-5-yl)piperidin-1-yl]methyl]-1,3-oxazole.
Molecular Properties
| Compound Name | 2-(4-chlorophenyl)-4-[[4-(1H-pyrazol-5-yl)piperidin-1-yl]methyl]-1,3-oxazole |
| PubChem CID | 51104412 |
| Molecular Formula | C18H19ClN4O |
| Molecular Weight | 342.83 g/mol |
| Exact Mass | 342.12 |
| IUPAC Name | 2-(4-chlorophenyl)-4-[[4-(1H-pyrazol-5-yl)piperidin-1-yl]methyl]-1,3-oxazole |
| SMILES | Clc1ccc(-c2nc(CN3CCC(c4ccn[nH]4)CC3)co2)cc1 |
| InChI | InChI=1S/C18H19ClN4O/c19-15-3-1-14(2-4-15)18-21-16(12-24-18)11-23-9-6-13(7-10-23)17-5-8-20-22-17/h1-5,8,12-13H,6-7,9-11H2,(H,20,22) |
| InChIKey | PUGZLEUJJNRUFE-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 57.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.83 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(4-chlorophenyl)-4-[[4-(1H-pyrazol-5-yl)piperidin-1-yl]methyl]-1,3-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-chlorophenyl)-4-[[4-(1H-pyrazol-5-yl)piperidin-1-yl]methyl]-1,3-oxazole?
The IUPAC name of 2-(4-chlorophenyl)-4-[[4-(1H-pyrazol-5-yl)piperidin-1-yl]methyl]-1,3-oxazole (CID 51104412) is 2-(4-chlorophenyl)-4-[[4-(1H-pyrazol-5-yl)piperidin-1-yl]methyl]-1,3-oxazole.
What is the SMILES notation for 2-(4-chlorophenyl)-4-[[4-(1H-pyrazol-5-yl)piperidin-1-yl]methyl]-1,3-oxazole?
The canonical SMILES for 2-(4-chlorophenyl)-4-[[4-(1H-pyrazol-5-yl)piperidin-1-yl]methyl]-1,3-oxazole is Clc1ccc(-c2nc(CN3CCC(c4ccn[nH]4)CC3)co2)cc1.
What is the InChIKey of 2-(4-chlorophenyl)-4-[[4-(1H-pyrazol-5-yl)piperidin-1-yl]methyl]-1,3-oxazole?
The InChIKey is PUGZLEUJJNRUFE-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19ClN4O/c19-15-3-1-14(2-4-15)18-21-16(12-24-18)11-23-9-6-13(7-10-23)17-5-8-20-22-17/h1-5,8,12-13H,6-7,9-11H2,(H,20,22).
What are the key properties of 2-(4-chlorophenyl)-4-[[4-(1H-pyrazol-5-yl)piperidin-1-yl]methyl]-1,3-oxazole?
2-(4-chlorophenyl)-4-[[4-(1H-pyrazol-5-yl)piperidin-1-yl]methyl]-1,3-oxazole has a molecular weight of 342.83 g/mol, XLogP of 4.10, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-chlorophenyl)-4-[[4-(1H-pyrazol-5-yl)piperidin-1-yl]methyl]-1,3-oxazole is sourced from PubChem (CID 51104412), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).