C17H19Cl2N3O2 — CID 120658276
1-[(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-2-[2-(4-chlorophenyl)-1,3-oxazol-4-yl]ethanone;hydrochloride (PubChem CID 120658276) has the molecular formula C17H19Cl2N3O2 and a molecular weight of 368.26 g/mol. Its IUPAC name is 1-[(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-2-[2-(4-chlorophenyl)-1,3-oxazol-4-yl]ethanone;hydrochloride.
| Compound Name | 1-[(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-2-[2-(4-chlorophenyl)-1,3-oxazol-4-yl]ethanone;hydrochloride |
|---|---|
| PubChem CID | 120658276 |
| Molecular Formula | C17H19Cl2N3O2 |
| Molecular Weight | 368.26 g/mol |
| Exact Mass | 367.09 |
| IUPAC Name | 1-[(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-2-[2-(4-chlorophenyl)-1,3-oxazol-4-yl]ethanone;hydrochloride |
| SMILES | Cl.O=C(Cc1coc(-c2ccc(Cl)cc2)n1)N1C[C@H]2CNC[C@H]2C1 |
| InChI | InChI=1S/C17H18ClN3O2.ClH/c18-14-3-1-11(2-4-14)17-20-15(10-23-17)5-16(22)21-8-12-6-19-7-13(12)9-21;/h1-4,10,12-13,19H,5-9H2;1H/t12-,13+; |
| InChIKey | JKFIICREWJAILA-OEEJBDNKSA-N |
| XLogP | 2.64 |
| TPSA | 58.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.26 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |