C9H6FNO — CID 141447377
4-fluoro-2-phenyl-1,3-oxazole (PubChem CID 141447377) has the molecular formula C9H6FNO and a molecular weight of 163.15 g/mol. Its IUPAC name is 4-fluoro-2-phenyl-1,3-oxazole.
| Compound Name | 4-fluoro-2-phenyl-1,3-oxazole |
|---|---|
| PubChem CID | 141447377 |
| Molecular Formula | C9H6FNO |
| Molecular Weight | 163.15 g/mol |
| Exact Mass | 163.04 |
| IUPAC Name | 4-fluoro-2-phenyl-1,3-oxazole |
| SMILES | Fc1coc(-c2ccccc2)n1 |
| InChI | InChI=1S/C9H6FNO/c10-8-6-12-9(11-8)7-4-2-1-3-5-7/h1-6H |
| InChIKey | ODXOPACECVUQNA-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.15 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |