C16H19NO4 — CID 59167756
methyl 5-[2-(2-methoxyphenyl)-1,3-oxazol-4-yl]pentanoate (PubChem CID 59167756) has the molecular formula C16H19NO4 and a molecular weight of 289.33 g/mol. Its IUPAC name is methyl 5-[2-(2-methoxyphenyl)-1,3-oxazol-4-yl]pentanoate.
| Compound Name | methyl 5-[2-(2-methoxyphenyl)-1,3-oxazol-4-yl]pentanoate |
|---|---|
| PubChem CID | 59167756 |
| Molecular Formula | C16H19NO4 |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | methyl 5-[2-(2-methoxyphenyl)-1,3-oxazol-4-yl]pentanoate |
| SMILES | COC(=O)CCCCc1coc(-c2ccccc2OC)n1 |
| InChI | InChI=1S/C16H19NO4/c1-19-14-9-5-4-8-13(14)16-17-12(11-21-16)7-3-6-10-15(18)20-2/h4-5,8-9,11H,3,6-7,10H2,1-2H3 |
| InChIKey | MEPGPWOEYRMFBT-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 61.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|