C12H12O3 — CID 15503045
(5-oxo-7,8-dihydro-6H-naphthalen-1-yl) acetate (PubChem CID 15503045) has the molecular formula C12H12O3 and a molecular weight of 204.22 g/mol. Its IUPAC name is (5-oxo-7,8-dihydro-6H-naphthalen-1-yl) acetate.
| Compound Name | (5-oxo-7,8-dihydro-6H-naphthalen-1-yl) acetate |
|---|---|
| PubChem CID | 15503045 |
| Molecular Formula | C12H12O3 |
| Molecular Weight | 204.22 g/mol |
| Exact Mass | 204.08 |
| IUPAC Name | (5-oxo-7,8-dihydro-6H-naphthalen-1-yl) acetate |
| SMILES | CC(=O)Oc1cccc2c1CCCC2=O |
| InChI | InChI=1S/C12H12O3/c1-8(13)15-12-7-3-4-9-10(12)5-2-6-11(9)14/h3-4,7H,2,5-6H2,1H3 |
| InChIKey | JWVOOZFFQQKCMU-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.22 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|