About ethyl 2-[(5-oxo-7,8-dihydro-6H-naphthalen-1-yl)oxy]pentanoate
ethyl 2-[(5-oxo-7,8-dihydro-6H-naphthalen-1-yl)oxy]pentanoate (PubChem CID 83040061) has the molecular formula C17H22O4
and a molecular weight of 290.36 g/mol. Its IUPAC name is ethyl 2-[(5-oxo-7,8-dihydro-6H-naphthalen-1-yl)oxy]pentanoate.
Analyze ethyl 2-[(5-oxo-7,8-dihydro-6H-naphthalen-1-yl)oxy]pentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[(5-oxo-7,8-dihydro-6H-naphthalen-1-yl)oxy]pentanoate?
The IUPAC name of ethyl 2-[(5-oxo-7,8-dihydro-6H-naphthalen-1-yl)oxy]pentanoate (CID 83040061) is ethyl 2-[(5-oxo-7,8-dihydro-6H-naphthalen-1-yl)oxy]pentanoate.
What is the SMILES notation for ethyl 2-[(5-oxo-7,8-dihydro-6H-naphthalen-1-yl)oxy]pentanoate?
The canonical SMILES for ethyl 2-[(5-oxo-7,8-dihydro-6H-naphthalen-1-yl)oxy]pentanoate is CCCC(Oc1cccc2c1CCCC2=O)C(=O)OCC.
What is the InChIKey of ethyl 2-[(5-oxo-7,8-dihydro-6H-naphthalen-1-yl)oxy]pentanoate?
The InChIKey is VTBTUNOSYUJLFR-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H22O4/c1-3-7-16(17(19)20-4-2)21-15-11-6-8-12-13(15)9-5-10-14(12)18/h6,8,11,16H,3-5,7,9-10H2,1-2H3.
What are the key properties of ethyl 2-[(5-oxo-7,8-dihydro-6H-naphthalen-1-yl)oxy]pentanoate?
ethyl 2-[(5-oxo-7,8-dihydro-6H-naphthalen-1-yl)oxy]pentanoate has a molecular weight of 290.36 g/mol, XLogP of 3.32, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[(5-oxo-7,8-dihydro-6H-naphthalen-1-yl)oxy]pentanoate is sourced from PubChem (CID 83040061), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).