C10H12S — CID 91411706
5-methyl-3,4-dihydro-1H-isothiochromene (PubChem CID 91411706) has the molecular formula C10H12S and a molecular weight of 164.27 g/mol. Its IUPAC name is 5-methyl-3,4-dihydro-1H-isothiochromene.
| Compound Name | 5-methyl-3,4-dihydro-1H-isothiochromene |
|---|---|
| PubChem CID | 91411706 |
| Molecular Formula | C10H12S |
| Molecular Weight | 164.27 g/mol |
| Exact Mass | 164.07 |
| IUPAC Name | 5-methyl-3,4-dihydro-1H-isothiochromene |
| SMILES | Cc1cccc2c1CCSC2 |
| InChI | InChI=1S/C10H12S/c1-8-3-2-4-9-7-11-6-5-10(8)9/h2-4H,5-7H2,1H3 |
| InChIKey | ISBHGBNPQAFKNZ-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.27 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |