C17H12OS — CID 154103054
8-thiatetracyclo[9.7.0.02,7.013,18]octadeca-1(11),2,4,6,13,15,17-heptaen-12-one (PubChem CID 154103054) has the molecular formula C17H12OS and a molecular weight of 264.35 g/mol. Its IUPAC name is 8-thiatetracyclo[9.7.0.02,7.013,18]octadeca-1(11),2,4,6,13,15,17-heptaen-12-one.
| Compound Name | 8-thiatetracyclo[9.7.0.02,7.013,18]octadeca-1(11),2,4,6,13,15,17-heptaen-12-one |
|---|---|
| PubChem CID | 154103054 |
| Molecular Formula | C17H12OS |
| Molecular Weight | 264.35 g/mol |
| Exact Mass | 264.06 |
| IUPAC Name | 8-thiatetracyclo[9.7.0.02,7.013,18]octadeca-1(11),2,4,6,13,15,17-heptaen-12-one |
| SMILES | O=C1C2=C(c3ccccc3SCC2)c2ccccc21 |
| InChI | InChI=1S/C17H12OS/c18-17-12-6-2-1-5-11(12)16-13-7-3-4-8-15(13)19-10-9-14(16)17/h1-8H,9-10H2 |
| InChIKey | XUNVRPPFVCHNHA-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.35 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |