C11H13NS — CID 63969242
(2Z)-2-(2,3-dihydrothiochromen-4-ylidene)ethanamine (PubChem CID 63969242) has the molecular formula C11H13NS and a molecular weight of 191.30 g/mol. Its IUPAC name is (2Z)-2-(2,3-dihydrothiochromen-4-ylidene)ethanamine.
| Compound Name | (2Z)-2-(2,3-dihydrothiochromen-4-ylidene)ethanamine |
|---|---|
| PubChem CID | 63969242 |
| Molecular Formula | C11H13NS |
| Molecular Weight | 191.30 g/mol |
| Exact Mass | 191.08 |
| IUPAC Name | (2Z)-2-(2,3-dihydrothiochromen-4-ylidene)ethanamine |
| SMILES | NC/C=C1/CCSc2ccccc21 |
| InChI | InChI=1S/C11H13NS/c12-7-5-9-6-8-13-11-4-2-1-3-10(9)11/h1-5H,6-8,12H2/b9-5- |
| InChIKey | ROXXGIMXQUTPKN-UITAMQMPSA-N |
| XLogP | 2.52 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.30 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |