About 3-(3,4-dihydro-2H-naphthalen-1-ylidene)propan-1-amine
3-(3,4-dihydro-2H-naphthalen-1-ylidene)propan-1-amine (PubChem CID 76997136) has the molecular formula C13H17N
and a molecular weight of 187.29 g/mol. Its IUPAC name is 3-(3,4-dihydro-2H-naphthalen-1-ylidene)propan-1-amine.
Analyze 3-(3,4-dihydro-2H-naphthalen-1-ylidene)propan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3,4-dihydro-2H-naphthalen-1-ylidene)propan-1-amine?
The IUPAC name of 3-(3,4-dihydro-2H-naphthalen-1-ylidene)propan-1-amine (CID 76997136) is 3-(3,4-dihydro-2H-naphthalen-1-ylidene)propan-1-amine.
What is the SMILES notation for 3-(3,4-dihydro-2H-naphthalen-1-ylidene)propan-1-amine?
The canonical SMILES for 3-(3,4-dihydro-2H-naphthalen-1-ylidene)propan-1-amine is NCCC=C1CCCc2ccccc21.
What is the InChIKey of 3-(3,4-dihydro-2H-naphthalen-1-ylidene)propan-1-amine?
The InChIKey is WSTRAVZAUUGGQZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17N/c14-10-4-8-12-7-3-6-11-5-1-2-9-13(11)12/h1-2,5,8-9H,3-4,6-7,10,14H2.
What are the key properties of 3-(3,4-dihydro-2H-naphthalen-1-ylidene)propan-1-amine?
3-(3,4-dihydro-2H-naphthalen-1-ylidene)propan-1-amine has a molecular weight of 187.29 g/mol, XLogP of 2.76, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3,4-dihydro-2H-naphthalen-1-ylidene)propan-1-amine is sourced from PubChem (CID 76997136), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).