About (1Z)-1-(3,4-dihydro-2H-naphthalen-1-ylidene)propan-2-ol
(1Z)-1-(3,4-dihydro-2H-naphthalen-1-ylidene)propan-2-ol (PubChem CID 103971061) has the molecular formula C13H16O
and a molecular weight of 188.27 g/mol. Its IUPAC name is (1Z)-1-(3,4-dihydro-2H-naphthalen-1-ylidene)propan-2-ol.
Molecular Properties
| Compound Name | (1Z)-1-(3,4-dihydro-2H-naphthalen-1-ylidene)propan-2-ol |
| PubChem CID | 103971061 |
| Molecular Formula | C13H16O |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.12 |
| IUPAC Name | (1Z)-1-(3,4-dihydro-2H-naphthalen-1-ylidene)propan-2-ol |
| SMILES | CC(O)/C=C1/CCCc2ccccc21 |
| InChI | InChI=1S/C13H16O/c1-10(14)9-12-7-4-6-11-5-2-3-8-13(11)12/h2-3,5,8-10,14H,4,6-7H2,1H3/b12-9- |
| InChIKey | MDHJYRGVASDEPV-XFXZXTDPSA-N |
| XLogP | 2.79 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (1Z)-1-(3,4-dihydro-2H-naphthalen-1-ylidene)propan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1Z)-1-(3,4-dihydro-2H-naphthalen-1-ylidene)propan-2-ol?
The IUPAC name of (1Z)-1-(3,4-dihydro-2H-naphthalen-1-ylidene)propan-2-ol (CID 103971061) is (1Z)-1-(3,4-dihydro-2H-naphthalen-1-ylidene)propan-2-ol.
What is the SMILES notation for (1Z)-1-(3,4-dihydro-2H-naphthalen-1-ylidene)propan-2-ol?
The canonical SMILES for (1Z)-1-(3,4-dihydro-2H-naphthalen-1-ylidene)propan-2-ol is CC(O)/C=C1/CCCc2ccccc21.
What is the InChIKey of (1Z)-1-(3,4-dihydro-2H-naphthalen-1-ylidene)propan-2-ol?
The InChIKey is MDHJYRGVASDEPV-XFXZXTDPSA-N. The full InChI is InChI=1S/C13H16O/c1-10(14)9-12-7-4-6-11-5-2-3-8-13(11)12/h2-3,5,8-10,14H,4,6-7H2,1H3/b12-9-.
What are the key properties of (1Z)-1-(3,4-dihydro-2H-naphthalen-1-ylidene)propan-2-ol?
(1Z)-1-(3,4-dihydro-2H-naphthalen-1-ylidene)propan-2-ol has a molecular weight of 188.27 g/mol, XLogP of 2.79, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (1Z)-1-(3,4-dihydro-2H-naphthalen-1-ylidene)propan-2-ol is sourced from PubChem (CID 103971061), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).