C13H14O — CID 142003176
(1E)-1-(3,4-dihydro-2H-naphthalen-1-ylidene)propan-2-one (PubChem CID 142003176) has the molecular formula C13H14O and a molecular weight of 186.25 g/mol. Its IUPAC name is (1E)-1-(3,4-dihydro-2H-naphthalen-1-ylidene)propan-2-one.
| Compound Name | (1E)-1-(3,4-dihydro-2H-naphthalen-1-ylidene)propan-2-one |
|---|---|
| PubChem CID | 142003176 |
| Molecular Formula | C13H14O |
| Molecular Weight | 186.25 g/mol |
| Exact Mass | 186.10 |
| IUPAC Name | (1E)-1-(3,4-dihydro-2H-naphthalen-1-ylidene)propan-2-one |
| SMILES | CC(=O)/C=C1\CCCc2ccccc21 |
| InChI | InChI=1S/C13H14O/c1-10(14)9-12-7-4-6-11-5-2-3-8-13(11)12/h2-3,5,8-9H,4,6-7H2,1H3/b12-9+ |
| InChIKey | ACDGWTFWHAKEJF-FMIVXFBMSA-N |
| XLogP | 3.00 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.25 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|