About (1Z)-1-(5-fluoro-2,3-dihydroinden-1-ylidene)propan-2-one
(1Z)-1-(5-fluoro-2,3-dihydroinden-1-ylidene)propan-2-one (PubChem CID 116532637) has the molecular formula C12H11FO
and a molecular weight of 190.22 g/mol. Its IUPAC name is (1Z)-1-(5-fluoro-2,3-dihydroinden-1-ylidene)propan-2-one.
Molecular Properties
| Compound Name | (1Z)-1-(5-fluoro-2,3-dihydroinden-1-ylidene)propan-2-one |
| PubChem CID | 116532637 |
| Molecular Formula | C12H11FO |
| Molecular Weight | 190.22 g/mol |
| Exact Mass | 190.08 |
| IUPAC Name | (1Z)-1-(5-fluoro-2,3-dihydroinden-1-ylidene)propan-2-one |
| SMILES | CC(=O)/C=C1/CCc2cc(F)ccc21 |
| InChI | InChI=1S/C12H11FO/c1-8(14)6-9-2-3-10-7-11(13)4-5-12(9)10/h4-7H,2-3H2,1H3/b9-6- |
| InChIKey | KGAXEOJQCGNURV-TWGQIWQCSA-N |
| XLogP | 2.74 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.22 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (1Z)-1-(5-fluoro-2,3-dihydroinden-1-ylidene)propan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1Z)-1-(5-fluoro-2,3-dihydroinden-1-ylidene)propan-2-one?
The IUPAC name of (1Z)-1-(5-fluoro-2,3-dihydroinden-1-ylidene)propan-2-one (CID 116532637) is (1Z)-1-(5-fluoro-2,3-dihydroinden-1-ylidene)propan-2-one.
What is the SMILES notation for (1Z)-1-(5-fluoro-2,3-dihydroinden-1-ylidene)propan-2-one?
The canonical SMILES for (1Z)-1-(5-fluoro-2,3-dihydroinden-1-ylidene)propan-2-one is CC(=O)/C=C1/CCc2cc(F)ccc21.
What is the InChIKey of (1Z)-1-(5-fluoro-2,3-dihydroinden-1-ylidene)propan-2-one?
The InChIKey is KGAXEOJQCGNURV-TWGQIWQCSA-N. The full InChI is InChI=1S/C12H11FO/c1-8(14)6-9-2-3-10-7-11(13)4-5-12(9)10/h4-7H,2-3H2,1H3/b9-6-.
What are the key properties of (1Z)-1-(5-fluoro-2,3-dihydroinden-1-ylidene)propan-2-one?
(1Z)-1-(5-fluoro-2,3-dihydroinden-1-ylidene)propan-2-one has a molecular weight of 190.22 g/mol, XLogP of 2.74, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (1Z)-1-(5-fluoro-2,3-dihydroinden-1-ylidene)propan-2-one is sourced from PubChem (CID 116532637), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).