C12H13NO2 — CID 10888983
(2E)-2-(5-methoxy-2,3-dihydroinden-1-ylidene)acetamide (PubChem CID 10888983) has the molecular formula C12H13NO2 and a molecular weight of 203.24 g/mol. Its IUPAC name is (2E)-2-(5-methoxy-2,3-dihydroinden-1-ylidene)acetamide.
| Compound Name | (2E)-2-(5-methoxy-2,3-dihydroinden-1-ylidene)acetamide |
|---|---|
| PubChem CID | 10888983 |
| Molecular Formula | C12H13NO2 |
| Molecular Weight | 203.24 g/mol |
| Exact Mass | 203.09 |
| IUPAC Name | (2E)-2-(5-methoxy-2,3-dihydroinden-1-ylidene)acetamide |
| SMILES | COc1ccc2c(c1)CC/C2=C\C(N)=O |
| InChI | InChI=1S/C12H13NO2/c1-15-10-4-5-11-8(6-10)2-3-9(11)7-12(13)14/h4-7H,2-3H2,1H3,(H2,13,14)/b9-7+ |
| InChIKey | ZMUOMFCRNYEMDX-VQHVLOKHSA-N |
| XLogP | 1.51 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.24 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|