C12H12O2 — CID 13275745
6-methoxy-3,4-dihydronaphthalene-1-carbaldehyde (PubChem CID 13275745) has the molecular formula C12H12O2 and a molecular weight of 188.23 g/mol. Its IUPAC name is 6-methoxy-3,4-dihydronaphthalene-1-carbaldehyde.
| Compound Name | 6-methoxy-3,4-dihydronaphthalene-1-carbaldehyde |
|---|---|
| PubChem CID | 13275745 |
| Molecular Formula | C12H12O2 |
| Molecular Weight | 188.23 g/mol |
| Exact Mass | 188.08 |
| IUPAC Name | 6-methoxy-3,4-dihydronaphthalene-1-carbaldehyde |
| SMILES | COc1ccc2c(c1)CCC=C2C=O |
| InChI | InChI=1S/C12H12O2/c1-14-11-5-6-12-9(7-11)3-2-4-10(12)8-13/h4-8H,2-3H2,1H3 |
| InChIKey | UELKMRUVSVAKBY-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.23 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|