C16H15NO2 — CID 102088801
6-methoxy-1-pyrrol-1-yl-3,4-dihydronaphthalene-2-carbaldehyde (PubChem CID 102088801) has the molecular formula C16H15NO2 and a molecular weight of 253.30 g/mol. Its IUPAC name is 6-methoxy-1-pyrrol-1-yl-3,4-dihydronaphthalene-2-carbaldehyde.
| Compound Name | 6-methoxy-1-pyrrol-1-yl-3,4-dihydronaphthalene-2-carbaldehyde |
|---|---|
| PubChem CID | 102088801 |
| Molecular Formula | C16H15NO2 |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.11 |
| IUPAC Name | 6-methoxy-1-pyrrol-1-yl-3,4-dihydronaphthalene-2-carbaldehyde |
| SMILES | COc1ccc2c(c1)CCC(C=O)=C2n1cccc1 |
| InChI | InChI=1S/C16H15NO2/c1-19-14-6-7-15-12(10-14)4-5-13(11-18)16(15)17-8-2-3-9-17/h2-3,6-11H,4-5H2,1H3 |
| InChIKey | UVVZDYGXNGVSPN-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|