C11H10O3 — CID 98053581
(2R)-6-methoxy-3-oxo-1,2-dihydroindene-2-carbaldehyde (PubChem CID 98053581) has the molecular formula C11H10O3 and a molecular weight of 190.20 g/mol. Its IUPAC name is (2R)-6-methoxy-3-oxo-1,2-dihydroindene-2-carbaldehyde.
| Compound Name | (2R)-6-methoxy-3-oxo-1,2-dihydroindene-2-carbaldehyde |
|---|---|
| PubChem CID | 98053581 |
| Molecular Formula | C11H10O3 |
| Molecular Weight | 190.20 g/mol |
| Exact Mass | 190.06 |
| IUPAC Name | (2R)-6-methoxy-3-oxo-1,2-dihydroindene-2-carbaldehyde |
| SMILES | COc1ccc2c(c1)C[C@H](C=O)C2=O |
| InChI | InChI=1S/C11H10O3/c1-14-9-2-3-10-7(5-9)4-8(6-12)11(10)13/h2-3,5-6,8H,4H2,1H3/t8-/m1/s1 |
| InChIKey | VIQWDFAWHLYXNF-MRVPVSSYSA-N |
| XLogP | 1.25 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.20 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|