C13H15BrO2 — CID 124560116
(2R)-2-bromo-6-methoxy-3,3-dimethyl-2,4-dihydronaphthalen-1-one (PubChem CID 124560116) has the molecular formula C13H15BrO2 and a molecular weight of 283.16 g/mol. Its IUPAC name is (2R)-2-bromo-6-methoxy-3,3-dimethyl-2,4-dihydronaphthalen-1-one.
| Compound Name | (2R)-2-bromo-6-methoxy-3,3-dimethyl-2,4-dihydronaphthalen-1-one |
|---|---|
| PubChem CID | 124560116 |
| Molecular Formula | C13H15BrO2 |
| Molecular Weight | 283.16 g/mol |
| Exact Mass | 282.03 |
| IUPAC Name | (2R)-2-bromo-6-methoxy-3,3-dimethyl-2,4-dihydronaphthalen-1-one |
| SMILES | COc1ccc2c(c1)CC(C)(C)[C@@H](Br)C2=O |
| InChI | InChI=1S/C13H15BrO2/c1-13(2)7-8-6-9(16-3)4-5-10(8)11(15)12(13)14/h4-6,12H,7H2,1-3H3/t12-/m0/s1 |
| InChIKey | LFRHGUOZMCWPDQ-LBPRGKRZSA-N |
| XLogP | 3.22 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.16 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|