C17H20O3 — CID 161055612
ethene;5-methoxyspiro[3H-indene-2,4'-cyclohexane]-1,1'-dione (PubChem CID 161055612) has the molecular formula C17H20O3 and a molecular weight of 272.34 g/mol. Its IUPAC name is ethene;5-methoxyspiro[3H-indene-2,4'-cyclohexane]-1,1'-dione.
| Compound Name | ethene;5-methoxyspiro[3H-indene-2,4'-cyclohexane]-1,1'-dione |
|---|---|
| PubChem CID | 161055612 |
| Molecular Formula | C17H20O3 |
| Molecular Weight | 272.34 g/mol |
| Exact Mass | 272.14 |
| IUPAC Name | ethene;5-methoxyspiro[3H-indene-2,4'-cyclohexane]-1,1'-dione |
| SMILES | C=C.COc1ccc2c(c1)CC1(CCC(=O)CC1)C2=O |
| InChI | InChI=1S/C15H16O3.C2H4/c1-18-12-2-3-13-10(8-12)9-15(14(13)17)6-4-11(16)5-7-15;1-2/h2-3,8H,4-7,9H2,1H3;1-2H2 |
| InChIKey | UCSAVGQGBUALFW-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.34 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|