C18H20O4 — CID 101410049
prop-2-enyl 6-methoxy-1-oxo-2-prop-2-enyl-3,4-dihydronaphthalene-2-carboxylate (PubChem CID 101410049) has the molecular formula C18H20O4 and a molecular weight of 300.35 g/mol. Its IUPAC name is prop-2-enyl 6-methoxy-1-oxo-2-prop-2-enyl-3,4-dihydronaphthalene-2-carboxylate.
| Compound Name | prop-2-enyl 6-methoxy-1-oxo-2-prop-2-enyl-3,4-dihydronaphthalene-2-carboxylate |
|---|---|
| PubChem CID | 101410049 |
| Molecular Formula | C18H20O4 |
| Molecular Weight | 300.35 g/mol |
| Exact Mass | 300.14 |
| IUPAC Name | prop-2-enyl 6-methoxy-1-oxo-2-prop-2-enyl-3,4-dihydronaphthalene-2-carboxylate |
| SMILES | C=CCOC(=O)C1(CC=C)CCc2cc(OC)ccc2C1=O |
| InChI | InChI=1S/C18H20O4/c1-4-9-18(17(20)22-11-5-2)10-8-13-12-14(21-3)6-7-15(13)16(18)19/h4-7,12H,1-2,8-11H2,3H3 |
| InChIKey | VHDFNNYXFYDKGR-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.35 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|