C21H20Cl2O2 — CID 132563408
5,6-bis(chloromethyl)-6'-methoxyspiro[1,3-dihydroindene-2,2'-3,4-dihydronaphthalene]-1'-one (PubChem CID 132563408) has the molecular formula C21H20Cl2O2 and a molecular weight of 375.30 g/mol. Its IUPAC name is 5,6-bis(chloromethyl)-6'-methoxyspiro[1,3-dihydroindene-2,2'-3,4-dihydronaphthalene]-1'-one.
| Compound Name | 5,6-bis(chloromethyl)-6'-methoxyspiro[1,3-dihydroindene-2,2'-3,4-dihydronaphthalene]-1'-one |
|---|---|
| PubChem CID | 132563408 |
| Molecular Formula | C21H20Cl2O2 |
| Molecular Weight | 375.30 g/mol |
| Exact Mass | 374.08 |
| IUPAC Name | 5,6-bis(chloromethyl)-6'-methoxyspiro[1,3-dihydroindene-2,2'-3,4-dihydronaphthalene]-1'-one |
| SMILES | COc1ccc2c(c1)CCC1(Cc3cc(CCl)c(CCl)cc3C1)C2=O |
| InChI | InChI=1S/C21H20Cl2O2/c1-25-18-2-3-19-13(8-18)4-5-21(20(19)24)9-14-6-16(11-22)17(12-23)7-15(14)10-21/h2-3,6-8H,4-5,9-12H2,1H3 |
| InChIKey | BNCRKCUOICAUHY-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.30 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|