C20H19ClO2 — CID 132563406
5-(chloromethyl)-6'-methoxyspiro[1,3-dihydroindene-2,2'-3,4-dihydronaphthalene]-1'-one (PubChem CID 132563406) has the molecular formula C20H19ClO2 and a molecular weight of 326.82 g/mol. Its IUPAC name is 5-(chloromethyl)-6'-methoxyspiro[1,3-dihydroindene-2,2'-3,4-dihydronaphthalene]-1'-one.
| Compound Name | 5-(chloromethyl)-6'-methoxyspiro[1,3-dihydroindene-2,2'-3,4-dihydronaphthalene]-1'-one |
|---|---|
| PubChem CID | 132563406 |
| Molecular Formula | C20H19ClO2 |
| Molecular Weight | 326.82 g/mol |
| Exact Mass | 326.11 |
| IUPAC Name | 5-(chloromethyl)-6'-methoxyspiro[1,3-dihydroindene-2,2'-3,4-dihydronaphthalene]-1'-one |
| SMILES | COc1ccc2c(c1)CCC1(Cc3ccc(CCl)cc3C1)C2=O |
| InChI | InChI=1S/C20H19ClO2/c1-23-17-4-5-18-14(9-17)6-7-20(19(18)22)10-15-3-2-13(12-21)8-16(15)11-20/h2-5,8-9H,6-7,10-12H2,1H3 |
| InChIKey | KXDDLGQVDKZRHL-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.82 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|