C12H11ClO3 — CID 121008324
2-(2-chloroacetyl)-5-methoxy-2,3-dihydroinden-1-one (PubChem CID 121008324) has the molecular formula C12H11ClO3 and a molecular weight of 238.67 g/mol. Its IUPAC name is 2-(2-chloroacetyl)-5-methoxy-2,3-dihydroinden-1-one.
| Compound Name | 2-(2-chloroacetyl)-5-methoxy-2,3-dihydroinden-1-one |
|---|---|
| PubChem CID | 121008324 |
| Molecular Formula | C12H11ClO3 |
| Molecular Weight | 238.67 g/mol |
| Exact Mass | 238.04 |
| IUPAC Name | 2-(2-chloroacetyl)-5-methoxy-2,3-dihydroinden-1-one |
| SMILES | COc1ccc2c(c1)CC(C(=O)CCl)C2=O |
| InChI | InChI=1S/C12H11ClO3/c1-16-8-2-3-9-7(4-8)5-10(12(9)15)11(14)6-13/h2-4,10H,5-6H2,1H3 |
| InChIKey | CGTXMUCZTBOMJH-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.67 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|