C14H16O2 — CID 154720213
2-but-3-en-2-yl-5-methoxy-2,3-dihydroinden-1-one (PubChem CID 154720213) has the molecular formula C14H16O2 and a molecular weight of 216.28 g/mol. Its IUPAC name is 2-but-3-en-2-yl-5-methoxy-2,3-dihydroinden-1-one.
| Compound Name | 2-but-3-en-2-yl-5-methoxy-2,3-dihydroinden-1-one |
|---|---|
| PubChem CID | 154720213 |
| Molecular Formula | C14H16O2 |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.12 |
| IUPAC Name | 2-but-3-en-2-yl-5-methoxy-2,3-dihydroinden-1-one |
| SMILES | C=CC(C)C1Cc2cc(OC)ccc2C1=O |
| InChI | InChI=1S/C14H16O2/c1-4-9(2)13-8-10-7-11(16-3)5-6-12(10)14(13)15/h4-7,9,13H,1,8H2,2-3H3 |
| InChIKey | WURNEXPJFCMPJC-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|