C22H24O2 — CID 10543706
(5S,11S)-2,8-dimethoxy-5,11-dimethyl-5,6,11,12-tetrahydrochrysene (PubChem CID 10543706) has the molecular formula C22H24O2 and a molecular weight of 320.43 g/mol. Its IUPAC name is (5S,11S)-2,8-dimethoxy-5,11-dimethyl-5,6,11,12-tetrahydrochrysene.
| Compound Name | (5S,11S)-2,8-dimethoxy-5,11-dimethyl-5,6,11,12-tetrahydrochrysene |
|---|---|
| PubChem CID | 10543706 |
| Molecular Formula | C22H24O2 |
| Molecular Weight | 320.43 g/mol |
| Exact Mass | 320.18 |
| IUPAC Name | (5S,11S)-2,8-dimethoxy-5,11-dimethyl-5,6,11,12-tetrahydrochrysene |
| SMILES | COc1ccc2c(c1)C[C@H](C)C1=C2[C@@H](C)Cc2cc(OC)ccc21 |
| InChI | InChI=1S/C22H24O2/c1-13-9-15-11-17(23-3)6-8-20(15)22-14(2)10-16-12-18(24-4)5-7-19(16)21(13)22/h5-8,11-14H,9-10H2,1-4H3/t13-,14-/m0/s1 |
| InChIKey | NDJYNKPHLIHATM-KBPBESRZSA-N |
| XLogP | 5.00 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.43 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|