C12H13NO — CID 70546059
6-methoxy-2,3,3a,4-tetrahydroindeno[2,1-b]pyrrole (PubChem CID 70546059) has the molecular formula C12H13NO and a molecular weight of 187.24 g/mol. Its IUPAC name is 6-methoxy-2,3,3a,4-tetrahydroindeno[2,1-b]pyrrole.
| Compound Name | 6-methoxy-2,3,3a,4-tetrahydroindeno[2,1-b]pyrrole |
|---|---|
| PubChem CID | 70546059 |
| Molecular Formula | C12H13NO |
| Molecular Weight | 187.24 g/mol |
| Exact Mass | 187.10 |
| IUPAC Name | 6-methoxy-2,3,3a,4-tetrahydroindeno[2,1-b]pyrrole |
| SMILES | COc1ccc2c(c1)CC1NCC=C21 |
| InChI | InChI=1S/C12H13NO/c1-14-9-2-3-10-8(6-9)7-12-11(10)4-5-13-12/h2-4,6,12-13H,5,7H2,1H3 |
| InChIKey | LPABIVCBBAGIHA-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.24 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |