C12H17NO — CID 62375759
3-ethyl-7-methoxy-1,2,3,4-tetrahydroisoquinoline (PubChem CID 62375759) has the molecular formula C12H17NO and a molecular weight of 191.27 g/mol. Its IUPAC name is 3-ethyl-7-methoxy-1,2,3,4-tetrahydroisoquinoline.
| Compound Name | 3-ethyl-7-methoxy-1,2,3,4-tetrahydroisoquinoline |
|---|---|
| PubChem CID | 62375759 |
| Molecular Formula | C12H17NO |
| Molecular Weight | 191.27 g/mol |
| Exact Mass | 191.13 |
| IUPAC Name | 3-ethyl-7-methoxy-1,2,3,4-tetrahydroisoquinoline |
| SMILES | CCC1Cc2ccc(OC)cc2CN1 |
| InChI | InChI=1S/C12H17NO/c1-3-11-6-9-4-5-12(14-2)7-10(9)8-13-11/h4-5,7,11,13H,3,6,8H2,1-2H3 |
| InChIKey | ZKSYYPPTJRFDRP-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.27 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |