C11H15NO2 — CID 130682443
[(3S)-6-methoxy-1,2,3,4-tetrahydroisoquinolin-3-yl]methanol (PubChem CID 130682443) has the molecular formula C11H15NO2 and a molecular weight of 193.25 g/mol. Its IUPAC name is [(3S)-6-methoxy-1,2,3,4-tetrahydroisoquinolin-3-yl]methanol.
| Compound Name | [(3S)-6-methoxy-1,2,3,4-tetrahydroisoquinolin-3-yl]methanol |
|---|---|
| PubChem CID | 130682443 |
| Molecular Formula | C11H15NO2 |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.11 |
| IUPAC Name | [(3S)-6-methoxy-1,2,3,4-tetrahydroisoquinolin-3-yl]methanol |
| SMILES | COc1ccc2c(c1)C[C@@H](CO)NC2 |
| InChI | InChI=1S/C11H15NO2/c1-14-11-3-2-8-6-12-10(7-13)4-9(8)5-11/h2-3,5,10,12-13H,4,6-7H2,1H3/t10-/m0/s1 |
| InChIKey | BQXMXIUUVWBEJR-JTQLQIEISA-N |
| XLogP | 0.70 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |