C15H22O — CID 134338473
2-(2,2-dimethylpropyl)-5-methoxy-2,3-dihydro-1H-indene (PubChem CID 134338473) has the molecular formula C15H22O and a molecular weight of 218.34 g/mol. Its IUPAC name is 2-(2,2-dimethylpropyl)-5-methoxy-2,3-dihydro-1H-indene.
| Compound Name | 2-(2,2-dimethylpropyl)-5-methoxy-2,3-dihydro-1H-indene |
|---|---|
| PubChem CID | 134338473 |
| Molecular Formula | C15H22O |
| Molecular Weight | 218.34 g/mol |
| Exact Mass | 218.17 |
| IUPAC Name | 2-(2,2-dimethylpropyl)-5-methoxy-2,3-dihydro-1H-indene |
| SMILES | COc1ccc2c(c1)CC(CC(C)(C)C)C2 |
| InChI | InChI=1S/C15H22O/c1-15(2,3)10-11-7-12-5-6-14(16-4)9-13(12)8-11/h5-6,9,11H,7-8,10H2,1-4H3 |
| InChIKey | CAYWBYVYSJYKRM-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.34 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |