C10H11N3O — CID 132528606
2-azido-5-methoxy-2,3-dihydro-1H-indene (PubChem CID 132528606) has the molecular formula C10H11N3O and a molecular weight of 189.22 g/mol. Its IUPAC name is 2-azido-5-methoxy-2,3-dihydro-1H-indene.
| Compound Name | 2-azido-5-methoxy-2,3-dihydro-1H-indene |
|---|---|
| PubChem CID | 132528606 |
| Molecular Formula | C10H11N3O |
| Molecular Weight | 189.22 g/mol |
| Exact Mass | 189.09 |
| IUPAC Name | 2-azido-5-methoxy-2,3-dihydro-1H-indene |
| SMILES | COc1ccc2c(c1)CC(N=[N+]=[N-])C2 |
| InChI | InChI=1S/C10H11N3O/c1-14-10-3-2-7-4-9(12-13-11)5-8(7)6-10/h2-3,6,9H,4-5H2,1H3 |
| InChIKey | SVSQVWQELMJNDA-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 57.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.22 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|