C10H11N3O — CID 91360016
(1R)-1-azido-6-methoxy-2,3-dihydro-1H-indene (PubChem CID 91360016) has the molecular formula C10H11N3O and a molecular weight of 189.22 g/mol. Its IUPAC name is (1R)-1-azido-6-methoxy-2,3-dihydro-1H-indene.
| Compound Name | (1R)-1-azido-6-methoxy-2,3-dihydro-1H-indene |
|---|---|
| PubChem CID | 91360016 |
| Molecular Formula | C10H11N3O |
| Molecular Weight | 189.22 g/mol |
| Exact Mass | 189.09 |
| IUPAC Name | (1R)-1-azido-6-methoxy-2,3-dihydro-1H-indene |
| SMILES | COc1ccc2c(c1)[C@H](N=[N+]=[N-])CC2 |
| InChI | InChI=1S/C10H11N3O/c1-14-8-4-2-7-3-5-10(12-13-11)9(7)6-8/h2,4,6,10H,3,5H2,1H3/t10-/m1/s1 |
| InChIKey | MIJZPIGXROPGAK-SNVBAGLBSA-N |
| XLogP | 2.99 |
| TPSA | 57.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.22 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|