C25H27N3OSi — CID 10971697
(3-azido-2,3-dihydro-1H-inden-5-yl)oxy-tert-butyl-diphenylsilane (PubChem CID 10971697) has the molecular formula C25H27N3OSi and a molecular weight of 413.60 g/mol. Its IUPAC name is (3-azido-2,3-dihydro-1H-inden-5-yl)oxy-tert-butyl-diphenylsilane.
| Compound Name | (3-azido-2,3-dihydro-1H-inden-5-yl)oxy-tert-butyl-diphenylsilane |
|---|---|
| PubChem CID | 10971697 |
| Molecular Formula | C25H27N3OSi |
| Molecular Weight | 413.60 g/mol |
| Exact Mass | 413.19 |
| IUPAC Name | (3-azido-2,3-dihydro-1H-inden-5-yl)oxy-tert-butyl-diphenylsilane |
| SMILES | CC(C)(C)[Si](Oc1ccc2c(c1)C(N=[N+]=[N-])CC2)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H27N3OSi/c1-25(2,3)30(21-10-6-4-7-11-21,22-12-8-5-9-13-22)29-20-16-14-19-15-17-24(27-28-26)23(19)18-20/h4-14,16,18,24H,15,17H2,1-3H3 |
| InChIKey | SNDLVSFTDZHGLA-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 57.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.60 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|