C9H9N3 — CID 89202215
(1R)-1-azido-2,3-dihydro-1H-indene (PubChem CID 89202215) has the molecular formula C9H9N3 and a molecular weight of 159.19 g/mol. Its IUPAC name is (1R)-1-azido-2,3-dihydro-1H-indene.
| Compound Name | (1R)-1-azido-2,3-dihydro-1H-indene |
|---|---|
| PubChem CID | 89202215 |
| Molecular Formula | C9H9N3 |
| Molecular Weight | 159.19 g/mol |
| Exact Mass | 159.08 |
| IUPAC Name | (1R)-1-azido-2,3-dihydro-1H-indene |
| SMILES | [N-]=[N+]=N[C@@H]1CCc2ccccc21 |
| InChI | InChI=1S/C9H9N3/c10-12-11-9-6-5-7-3-1-2-4-8(7)9/h1-4,9H,5-6H2/t9-/m1/s1 |
| InChIKey | DRYHUFGCDZWXBZ-SECBINFHSA-N |
| XLogP | 2.98 |
| TPSA | 48.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.19 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|