C17H17N3O — CID 10826537
(1S,2R)-1-azido-2-(2-methoxyphenyl)-1,2,3,4-tetrahydronaphthalene (PubChem CID 10826537) has the molecular formula C17H17N3O and a molecular weight of 279.34 g/mol. Its IUPAC name is (1S,2R)-1-azido-2-(2-methoxyphenyl)-1,2,3,4-tetrahydronaphthalene.
| Compound Name | (1S,2R)-1-azido-2-(2-methoxyphenyl)-1,2,3,4-tetrahydronaphthalene |
|---|---|
| PubChem CID | 10826537 |
| Molecular Formula | C17H17N3O |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.14 |
| IUPAC Name | (1S,2R)-1-azido-2-(2-methoxyphenyl)-1,2,3,4-tetrahydronaphthalene |
| SMILES | COc1ccccc1[C@H]1CCc2ccccc2[C@H]1N=[N+]=[N-] |
| InChI | InChI=1S/C17H17N3O/c1-21-16-9-5-4-8-14(16)15-11-10-12-6-2-3-7-13(12)17(15)19-20-18/h2-9,15,17H,10-11H2,1H3/t15-,17-/m1/s1 |
| InChIKey | CRLOGNJRAVDUSC-NVXWUHKLSA-N |
| XLogP | 4.78 |
| TPSA | 57.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|