C12H15N3O — CID 14437044
1-(azidomethyl)-5-methoxy-1,2,3,4-tetrahydronaphthalene (PubChem CID 14437044) has the molecular formula C12H15N3O and a molecular weight of 217.27 g/mol. Its IUPAC name is 1-(azidomethyl)-5-methoxy-1,2,3,4-tetrahydronaphthalene.
| Compound Name | 1-(azidomethyl)-5-methoxy-1,2,3,4-tetrahydronaphthalene |
|---|---|
| PubChem CID | 14437044 |
| Molecular Formula | C12H15N3O |
| Molecular Weight | 217.27 g/mol |
| Exact Mass | 217.12 |
| IUPAC Name | 1-(azidomethyl)-5-methoxy-1,2,3,4-tetrahydronaphthalene |
| SMILES | COc1cccc2c1CCCC2CN=[N+]=[N-] |
| InChI | InChI=1S/C12H15N3O/c1-16-12-7-3-5-10-9(8-14-15-13)4-2-6-11(10)12/h3,5,7,9H,2,4,6,8H2,1H3 |
| InChIKey | WSZDKBFNAHQSPO-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 57.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.27 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|